C22H37IN4O2S — CID 109484274
3-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide (PubChem CID 109484274) has the molecular formula C22H37IN4O2S and a molecular weight of 548.54 g/mol. Its IUPAC name is 3-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109484274 |
| Molecular Formula | C22H37IN4O2S |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 3-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC1CCN(S(=O)(=O)c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H36N4O2S.HI/c1-4-5-6-7-11-16-25(3)22(23-2)24-19-20-14-17-26(18-15-20)29(27,28)21-12-9-8-10-13-21;/h4,8-10,12-13,20H,1,5-7,11,14-19H2,2-3H3,(H,23,24);1H |
| InChIKey | IVAMFROUPMLGIC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|