C21H33IN4O — CID 109483492
3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide (PubChem CID 109483492) has the molecular formula C21H33IN4O and a molecular weight of 484.43 g/mol. Its IUPAC name is 3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109483492 |
| Molecular Formula | C21H33IN4O |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCC(=O)N1CCc2ccccc2C1.I |
| InChI | InChI=1S/C21H32N4O.HI/c1-4-5-6-7-10-14-24(3)21(22-2)23-16-20(26)25-15-13-18-11-8-9-12-19(18)17-25;/h4,8-9,11-12H,1,5-7,10,13-17H2,2-3H3,(H,22,23);1H |
| InChIKey | SNCFQSOUNWPODQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|