C22H36N6O — CID 109483879
1-hept-6-enyl-1,2-dimethyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 109483879) has the molecular formula C22H36N6O and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-hept-6-enyl-1,2-dimethyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-hept-6-enyl-1,2-dimethyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109483879 |
| Molecular Formula | C22H36N6O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 1-hept-6-enyl-1,2-dimethyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCC(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H36N6O/c1-4-5-6-7-10-15-26(3)22(23-2)25-14-12-21(29)28-18-16-27(17-19-28)20-11-8-9-13-24-20/h4,8-9,11,13H,1,5-7,10,12,14-19H2,2-3H3,(H,23,25) |
| InChIKey | MSMOSJVNGDBOBW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|