C19H33Cl2N5O2 — CID 119870734
7-amino-N-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]heptanamide;dihydrochloride (PubChem CID 119870734) has the molecular formula C19H33Cl2N5O2 and a molecular weight of 434.41 g/mol. Its IUPAC name is 7-amino-N-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119870734 |
| Molecular Formula | C19H33Cl2N5O2 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 7-amino-N-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]heptanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCCC(=O)NCCC(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C19H31N5O2.2ClH/c20-10-5-2-1-3-8-18(25)22-12-9-19(26)24-15-13-23(14-16-24)17-7-4-6-11-21-17;;/h4,6-7,11H,1-3,5,8-10,12-16,20H2,(H,22,25);2*1H |
| InChIKey | LORTYLLEHVXTME-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|