C18H31IN6O — CID 111092171
2-(3-methylbutyl)-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111092171) has the molecular formula C18H31IN6O and a molecular weight of 474.39 g/mol. Its IUPAC name is 2-(3-methylbutyl)-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-(3-methylbutyl)-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111092171 |
| Molecular Formula | C18H31IN6O |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-(3-methylbutyl)-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CC(C)CC/N=C(\N)NCCC(=O)N1CCN(c2ccccn2)CC1.I |
| InChI | InChI=1S/C18H30N6O.HI/c1-15(2)6-9-21-18(19)22-10-7-17(25)24-13-11-23(12-14-24)16-5-3-4-8-20-16;/h3-5,8,15H,6-7,9-14H2,1-2H3,(H3,19,21,22);1H |
| InChIKey | QGDUHXZQPWIFRR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|