C23H33IN6OS — CID 111676657
2-methyl-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-(2-phenylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111676657) has the molecular formula C23H33IN6OS and a molecular weight of 568.53 g/mol. Its IUPAC name is 2-methyl-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-(2-phenylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-(2-phenylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111676657 |
| Molecular Formula | C23H33IN6OS |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 2-methyl-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-(2-phenylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCC(=O)N1CCN(c2ccccn2)CC1)NCC(C)Sc1ccccc1.I |
| InChI | InChI=1S/C23H32N6OS.HI/c1-19(31-20-8-4-3-5-9-20)18-27-23(24-2)26-13-11-22(30)29-16-14-28(15-17-29)21-10-6-7-12-25-21;/h3-10,12,19H,11,13-18H2,1-2H3,(H2,24,26,27);1H |
| InChIKey | JXWMECMHLOWLHH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|