C22H27F3N6O — CID 111421143
2-methyl-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111421143) has the molecular formula C22H27F3N6O and a molecular weight of 448.49 g/mol. Its IUPAC name is 2-methyl-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111421143 |
| Molecular Formula | C22H27F3N6O |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-methyl-1-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCCC(=O)N1CCN(c2ccccn2)CC1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H27F3N6O/c1-26-21(29-16-17-5-7-18(8-6-17)22(23,24)25)28-11-9-20(32)31-14-12-30(13-15-31)19-4-2-3-10-27-19/h2-8,10H,9,11-16H2,1H3,(H2,26,28,29) |
| InChIKey | GRDBFAPCYIDLSL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|