C23H40IN7O — CID 111325503
1-[3-(azepan-1-yl)propyl]-2-methyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111325503) has the molecular formula C23H40IN7O and a molecular weight of 557.53 g/mol. Its IUPAC name is 1-[3-(azepan-1-yl)propyl]-2-methyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(azepan-1-yl)propyl]-2-methyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111325503 |
| Molecular Formula | C23H40IN7O |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 1-[3-(azepan-1-yl)propyl]-2-methyl-3-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCCCCC1)NCCC(=O)N1CCN(c2ccccn2)CC1.I |
| InChI | InChI=1S/C23H39N7O.HI/c1-24-23(26-12-8-16-28-14-6-2-3-7-15-28)27-13-10-22(31)30-19-17-29(18-20-30)21-9-4-5-11-25-21;/h4-5,9,11H,2-3,6-8,10,12-20H2,1H3,(H2,24,26,27);1H |
| InChIKey | JDMPWONJUBNUGS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|