C23H29N5O — CID 110946842
N'-methyl-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 110946842) has the molecular formula C23H29N5O and a molecular weight of 391.52 g/mol. Its IUPAC name is N'-methyl-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-methyl-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 110946842 |
| Molecular Formula | C23H29N5O |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | N'-methyl-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | C/N=C(\NCC(=O)N1CCN(c2ccccc2)CC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H29N5O/c1-24-23(28-12-11-19-7-5-6-8-20(19)18-28)25-17-22(29)27-15-13-26(14-16-27)21-9-3-2-4-10-21/h2-10H,11-18H2,1H3,(H,24,25) |
| InChIKey | HWLPKDYICOSOSD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|