C20H32IN5OS — CID 109485068
2-ethyl-N'-methyl-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109485068) has the molecular formula C20H32IN5OS and a molecular weight of 517.48 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N'-methyl-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109485068 |
| Molecular Formula | C20H32IN5OS |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N\C)NCC(=O)N2CCN(c3ccccc3)CC2)CCS1.I |
| InChI | InChI=1S/C20H31N5OS.HI/c1-3-18-16-25(13-14-27-18)20(21-2)22-15-19(26)24-11-9-23(10-12-24)17-7-5-4-6-8-17;/h4-8,18H,3,9-16H2,1-2H3,(H,21,22);1H |
| InChIKey | IVCOIFICRODGFR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|