C19H28N4S — CID 109484898
N-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide (PubChem CID 109484898) has the molecular formula C19H28N4S and a molecular weight of 344.53 g/mol. Its IUPAC name is N-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide.
| Compound Name | N-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109484898 |
| Molecular Formula | C19H28N4S |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | N-[[3-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-ethyl-N'-methylthiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N\C)NCc2cccc(N3CC=CC3)c2)CCS1 |
| InChI | InChI=1S/C19H28N4S/c1-3-18-15-23(11-12-24-18)19(20-2)21-14-16-7-6-8-17(13-16)22-9-4-5-10-22/h4-8,13,18H,3,9-12,14-15H2,1-2H3,(H,20,21) |
| InChIKey | GHGVUDKPJRZYPC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|