C19H30N4S — CID 109485894
2-ethyl-N'-methyl-N-[(1-phenylpyrrolidin-3-yl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 109485894) has the molecular formula C19H30N4S and a molecular weight of 346.54 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[(1-phenylpyrrolidin-3-yl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N'-methyl-N-[(1-phenylpyrrolidin-3-yl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485894 |
| Molecular Formula | C19H30N4S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[(1-phenylpyrrolidin-3-yl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N/C)NCC2CCN(c3ccccc3)C2)CCS1 |
| InChI | InChI=1S/C19H30N4S/c1-3-18-15-23(11-12-24-18)19(20-2)21-13-16-9-10-22(14-16)17-7-5-4-6-8-17/h4-8,16,18H,3,9-15H2,1-2H3,(H,20,21) |
| InChIKey | JMAMKDAKSSQGHR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|