C17H24N6S — CID 109486040
2-ethyl-N'-methyl-N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 109486040) has the molecular formula C17H24N6S and a molecular weight of 344.49 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N'-methyl-N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486040 |
| Molecular Formula | C17H24N6S |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[[3-(1H-1,2,4-triazol-5-yl)phenyl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N\C)NCc2cccc(-c3ncn[nH]3)c2)CCS1 |
| InChI | InChI=1S/C17H24N6S/c1-3-15-11-23(7-8-24-15)17(18-2)19-10-13-5-4-6-14(9-13)16-20-12-21-22-16/h4-6,9,12,15H,3,7-8,10-11H2,1-2H3,(H,18,19)(H,20,21,22) |
| InChIKey | MMRMFJAYSSGNNF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|