C16H24FN3OS — CID 109486412
2-ethyl-N-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-N'-methylthiomorpholine-4-carboximidamide (PubChem CID 109486412) has the molecular formula C16H24FN3OS and a molecular weight of 325.45 g/mol. Its IUPAC name is 2-ethyl-N-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-N'-methylthiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-N'-methylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109486412 |
| Molecular Formula | C16H24FN3OS |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-ethyl-N-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-N'-methylthiomorpholine-4-carboximidamide |
| SMILES | CCC1CN(/C(=N\C)NCc2ccc(F)c(CO)c2)CCS1 |
| InChI | InChI=1S/C16H24FN3OS/c1-3-14-10-20(6-7-22-14)16(18-2)19-9-12-4-5-15(17)13(8-12)11-21/h4-5,8,14,21H,3,6-7,9-11H2,1-2H3,(H,18,19) |
| InChIKey | NUJBFWXIDDJVQE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|