C13H22IN3S2 — CID 109486137
2-ethyl-N'-methyl-N-(thiophen-3-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486137) has the molecular formula C13H22IN3S2 and a molecular weight of 411.38 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-(thiophen-3-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N'-methyl-N-(thiophen-3-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486137 |
| Molecular Formula | C13H22IN3S2 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 2-ethyl-N'-methyl-N-(thiophen-3-ylmethyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCc2ccsc2)CCS1.I |
| InChI | InChI=1S/C13H21N3S2.HI/c1-3-12-9-16(5-7-18-12)13(14-2)15-8-11-4-6-17-10-11;/h4,6,10,12H,3,5,7-9H2,1-2H3,(H,14,15);1H |
| InChIKey | BMYXPNOEFKHGSU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|