C21H26BrIN4O — CID 111293118
1-[(4-bromophenyl)methyl]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111293118) has the molecular formula C21H26BrIN4O and a molecular weight of 557.27 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111293118 |
| Molecular Formula | C21H26BrIN4O |
| Molecular Weight | 557.27 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC(=O)N1CCc2ccccc2C1)N(C)Cc1ccc(Br)cc1.I |
| InChI | InChI=1S/C21H25BrN4O.HI/c1-23-21(25(2)14-16-7-9-19(22)10-8-16)24-13-20(27)26-12-11-17-5-3-4-6-18(17)15-26;/h3-10H,11-15H2,1-2H3,(H,23,24);1H |
| InChIKey | DNPLMNQGKMLSSW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|