C19H23FN4OS — CID 111307292
3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111307292) has the molecular formula C19H23FN4OS and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111307292 |
| Molecular Formula | C19H23FN4OS |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-[(4-fluorophenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCC(=O)N1CCc2sccc2C1)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C19H23FN4OS/c1-21-19(23(2)12-14-3-5-16(20)6-4-14)22-11-18(25)24-9-7-17-15(13-24)8-10-26-17/h3-6,8,10H,7,9,11-13H2,1-2H3,(H,21,22) |
| InChIKey | MRSKXRDEXDMTSU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|