C22H31IN4O2S — CID 111274636
3-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111274636) has the molecular formula C22H31IN4O2S and a molecular weight of 542.49 g/mol. Its IUPAC name is 3-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111274636 |
| Molecular Formula | C22H31IN4O2S |
| Molecular Weight | 542.49 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 3-[3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-oxopropyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCOc1ccc(CN(C)/C(=N\C)NCCC(=O)N2CCc3sccc3C2)cc1.I |
| InChI | InChI=1S/C22H30N4O2S.HI/c1-4-28-19-7-5-17(6-8-19)15-25(3)22(23-2)24-12-9-21(27)26-13-10-20-18(16-26)11-14-29-20;/h5-8,11,14H,4,9-10,12-13,15-16H2,1-3H3,(H,23,24);1H |
| InChIKey | QXTJVMFIQMBOGC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|