C20H26FIN4O2S — CID 111678549
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111678549) has the molecular formula C20H26FIN4O2S and a molecular weight of 532.42 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111678549 |
| Molecular Formula | C20H26FIN4O2S |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC(=O)N1CCc2sccc2C1)NCC(C)Oc1ccc(F)cc1.I |
| InChI | InChI=1S/C20H25FN4O2S.HI/c1-14(27-17-5-3-16(21)4-6-17)11-23-20(22-2)24-12-19(26)25-9-7-18-15(13-25)8-10-28-18;/h3-6,8,10,14H,7,9,11-13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | HHNQRDSLHPKCMZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|