C18H25IN4OS2 — CID 111956954
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[(5-ethylthiophen-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111956954) has the molecular formula C18H25IN4OS2 and a molecular weight of 504.46 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[(5-ethylthiophen-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[(5-ethylthiophen-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111956954 |
| Molecular Formula | C18H25IN4OS2 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[(5-ethylthiophen-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1ccc(CN/C(=N\C)NCC(=O)N2CCc3sccc3C2)s1.I |
| InChI | InChI=1S/C18H24N4OS2.HI/c1-3-14-4-5-15(25-14)10-20-18(19-2)21-11-17(23)22-8-6-16-13(12-22)7-9-24-16;/h4-5,7,9H,3,6,8,10-12H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | RLIAZSGANZLOTC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|