C22H26IN5O2S — CID 111592066
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111592066) has the molecular formula C22H26IN5O2S and a molecular weight of 551.45 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111592066 |
| Molecular Formula | C22H26IN5O2S |
| Molecular Weight | 551.45 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC(=O)N1CCc2sccc2C1)NCc1coc(-c2ccc(C)cc2)n1.I |
| InChI | InChI=1S/C22H25N5O2S.HI/c1-15-3-5-16(6-4-15)21-26-18(14-29-21)11-24-22(23-2)25-12-20(28)27-9-7-19-17(13-27)8-10-30-19;/h3-6,8,10,14H,7,9,11-13H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | DJCFZIYAFHVEQN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|