C18H26IN5OS2 — CID 111533162
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111533162) has the molecular formula C18H26IN5OS2 and a molecular weight of 519.48 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111533162 |
| Molecular Formula | C18H26IN5OS2 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NCC(=O)N2CCc3sccc3C2)s1.I |
| InChI | InChI=1S/C18H25N5OS2.HI/c1-3-14-10-21-16(26-14)4-7-20-18(19-2)22-11-17(24)23-8-5-15-13(12-23)6-9-25-15;/h6,9-10H,3-5,7-8,11-12H2,1-2H3,(H2,19,20,22);1H |
| InChIKey | SUPIBVOSBNZPFO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|