C20H24F3IN4OS — CID 111295624
1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide (PubChem CID 111295624) has the molecular formula C20H24F3IN4OS and a molecular weight of 552.40 g/mol. Its IUPAC name is 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111295624 |
| Molecular Formula | C20H24F3IN4OS |
| Molecular Weight | 552.40 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | 1-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-2-methyl-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(C(F)(F)F)cc1)NCC(=O)N1CCc2sccc2C1.I |
| InChI | InChI=1S/C20H23F3N4OS.HI/c1-24-19(25-9-6-14-2-4-16(5-3-14)20(21,22)23)26-12-18(28)27-10-7-17-15(13-27)8-11-29-17;/h2-5,8,11H,6-7,9-10,12-13H2,1H3,(H2,24,25,26);1H |
| InChIKey | HAWTZRCNPHURJX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|