C19H26N4OS2 — CID 111957727
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[(5-ethylthiophen-2-yl)methyl]guanidine (PubChem CID 111957727) has the molecular formula C19H26N4OS2 and a molecular weight of 390.58 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[(5-ethylthiophen-2-yl)methyl]guanidine.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[(5-ethylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111957727 |
| Molecular Formula | C19H26N4OS2 |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[(5-ethylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(=O)N1CCc2sccc2C1)NCc1ccc(CC)s1 |
| InChI | InChI=1S/C19H26N4OS2/c1-3-15-5-6-16(26-15)11-21-19(20-4-2)22-12-18(24)23-9-7-17-14(13-23)8-10-25-17/h5-6,8,10H,3-4,7,9,11-13H2,1-2H3,(H2,20,21,22) |
| InChIKey | LKDFPSDBKKTQKV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|