C15H22N4OS — CID 110982205
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-prop-2-enylguanidine (PubChem CID 110982205) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-prop-2-enylguanidine.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110982205 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N/CC(=O)N1CCc2sccc2C1)NCC |
| InChI | InChI=1S/C15H22N4OS/c1-3-7-17-15(16-4-2)18-10-14(20)19-8-5-13-12(11-19)6-9-21-13/h3,6,9H,1,4-5,7-8,10-11H2,2H3,(H2,16,17,18) |
| InChIKey | HFBGNVHHRDVHCD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|