C17H23IN4O2S — CID 110938449
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110938449) has the molecular formula C17H23IN4O2S and a molecular weight of 474.37 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110938449 |
| Molecular Formula | C17H23IN4O2S |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2sccc2C1)NCc1ccco1.I |
| InChI | InChI=1S/C17H22N4O2S.HI/c1-2-18-17(19-10-14-4-3-8-23-14)20-11-16(22)21-7-5-15-13(12-21)6-9-24-15;/h3-4,6,8-9H,2,5,7,10-12H2,1H3,(H2,18,19,20);1H |
| InChIKey | WQPOESNCCQESHB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|