C23H33N5O2S — CID 111304559
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine (PubChem CID 111304559) has the molecular formula C23H33N5O2S and a molecular weight of 443.62 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111304559 |
| Molecular Formula | C23H33N5O2S |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(=O)N1CCc2sccc2C1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C23H33N5O2S/c1-2-24-23(26-16-22(29)28-12-8-21-18(17-28)9-14-31-21)25-15-19(20-7-6-13-30-20)27-10-4-3-5-11-27/h6-7,9,13-14,19H,2-5,8,10-12,15-17H2,1H3,(H2,24,25,26) |
| InChIKey | YNZDQSHXBJTNNO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|