C21H35IN4O2S — CID 109476610
2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide (PubChem CID 109476610) has the molecular formula C21H35IN4O2S and a molecular weight of 534.51 g/mol. Its IUPAC name is 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109476610 |
| Molecular Formula | C21H35IN4O2S |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 2-[2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-oxoethyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2sccc2C1)NCC1(CCO)CCCCC1.I |
| InChI | InChI=1S/C21H34N4O2S.HI/c1-2-22-20(24-16-21(10-12-26)8-4-3-5-9-21)23-14-19(27)25-11-6-18-17(15-25)7-13-28-18;/h7,13,26H,2-6,8-12,14-16H2,1H3,(H2,22,23,24);1H |
| InChIKey | DXJIZEBAHICHIB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|