C20H22N2O2 — CID 108946045
N-benzyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methyl-3-oxopropanamide (PubChem CID 108946045) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-benzyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methyl-3-oxopropanamide.
| Compound Name | N-benzyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108946045 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-benzyl-3-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methyl-3-oxopropanamide |
| SMILES | CN(Cc1ccccc1)C(=O)CC(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H22N2O2/c1-21(14-16-7-3-2-4-8-16)19(23)13-20(24)22-12-11-17-9-5-6-10-18(17)15-22/h2-10H,11-15H2,1H3 |
| InChIKey | QBHZEBQCMKWLTC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|