C21H34N4O2S — CID 111153437
N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-N',3,5-trimethylpiperidine-1-carboximidamide (PubChem CID 111153437) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-N',3,5-trimethylpiperidine-1-carboximidamide.
| Compound Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-N',3,5-trimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111153437 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-N',3,5-trimethylpiperidine-1-carboximidamide |
| SMILES | C/N=C(/NCC1CCN(S(=O)(=O)c2ccccc2)CC1)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C21H34N4O2S/c1-17-13-18(2)16-24(15-17)21(22-3)23-14-19-9-11-25(12-10-19)28(26,27)20-7-5-4-6-8-20/h4-8,17-19H,9-16H2,1-3H3,(H,22,23) |
| InChIKey | CIRMASTZOGPFAP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|