C21H35IN4O3S — CID 111960616
N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111960616) has the molecular formula C21H35IN4O3S and a molecular weight of 550.51 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111960616 |
| Molecular Formula | C21H35IN4O3S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOC1CCN(/C(=N\C)NCC2CCN(S(=O)(=O)c3ccccc3)CC2)CC1.I |
| InChI | InChI=1S/C21H34N4O3S.HI/c1-3-28-19-11-13-24(14-12-19)21(22-2)23-17-18-9-15-25(16-10-18)29(26,27)20-7-5-4-6-8-20;/h4-8,18-19H,3,9-17H2,1-2H3,(H,22,23);1H |
| InChIKey | JFHRKIMIMWGFDQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|