C20H31IN6O3 — CID 111367858
1-(1,3-benzodioxol-5-ylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-methylguanidine;hydroiodide (PubChem CID 111367858) has the molecular formula C20H31IN6O3 and a molecular weight of 530.41 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111367858 |
| Molecular Formula | C20H31IN6O3 |
| Molecular Weight | 530.41 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(3-ethoxypropyl)-1-methylguanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\Cc1nnc(C)n1C)N(C)Cc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C20H30N6O3.HI/c1-5-27-10-6-9-21-20(22-12-19-24-23-15(2)26(19)4)25(3)13-16-7-8-17-18(11-16)29-14-28-17;/h7-8,11H,5-6,9-10,12-14H2,1-4H3,(H,21,22);1H |
| InChIKey | VMHCPCUHXDLJLY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|