C20H33F2IN4O2 — CID 111288320
1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide (PubChem CID 111288320) has the molecular formula C20H33F2IN4O2 and a molecular weight of 526.41 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111288320 |
| Molecular Formula | C20H33F2IN4O2 |
| Molecular Weight | 526.41 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-ethyl-1-methyl-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1CCOCC1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C20H32F2N4O2.HI/c1-3-23-20(24-10-4-5-11-26-12-14-27-15-13-26)25(2)16-17-6-8-18(9-7-17)28-19(21)22;/h6-9,19H,3-5,10-16H2,1-2H3,(H,23,24);1H |
| InChIKey | YHLXHOQCOBFWKO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|