C20H32N4O2S — CID 111662143
2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 111662143) has the molecular formula C20H32N4O2S and a molecular weight of 392.57 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111662143 |
| Molecular Formula | C20H32N4O2S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCCc1csc(C(C)C)n1 |
| InChI | InChI=1S/C20H32N4O2S/c1-7-21-19(22-9-8-16-11-27-18(24-16)13(2)3)23-12-20(6,25)17-10-14(4)26-15(17)5/h10-11,13,25H,7-9,12H2,1-6H3,(H2,21,22,23) |
| InChIKey | ZXYLAYLRSLSTAI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|