C16H22F3N5S2 — CID 111617000
1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine (PubChem CID 111617000) has the molecular formula C16H22F3N5S2 and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111617000 |
| Molecular Formula | C16H22F3N5S2 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-ethyl-3-[2-(2-propan-2-yl-1,3-thiazol-4-yl)ethyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCc1csc(C(C)C)n1 |
| InChI | InChI=1S/C16H22F3N5S2/c1-4-20-15(21-6-5-11-8-26-14(23-11)10(2)3)22-7-13-24-12(9-25-13)16(17,18)19/h8-10H,4-7H2,1-3H3,(H2,20,21,22) |
| InChIKey | OEJQYSNEESINFA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|