C22H23N3O2 — CID 146168165
tert-butyl N-[1-(4-cyanophenyl)-2-(1H-indol-3-yl)ethyl]carbamate (PubChem CID 146168165) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is tert-butyl N-[1-(4-cyanophenyl)-2-(1H-indol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-cyanophenyl)-2-(1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 146168165 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | tert-butyl N-[1-(4-cyanophenyl)-2-(1H-indol-3-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1c[nH]c2ccccc12)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H23N3O2/c1-22(2,3)27-21(26)25-20(16-10-8-15(13-23)9-11-16)12-17-14-24-19-7-5-4-6-18(17)19/h4-11,14,20,24H,12H2,1-3H3,(H,25,26) |
| InChIKey | BIQJWJFELICQOP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |