C13H16N2O3 — CID 146559463
[(2R)-1-(4-cyanophenyl)-3-hydroxy-3-methylbutan-2-yl]carbamic acid (PubChem CID 146559463) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is [(2R)-1-(4-cyanophenyl)-3-hydroxy-3-methylbutan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-(4-cyanophenyl)-3-hydroxy-3-methylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 146559463 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [(2R)-1-(4-cyanophenyl)-3-hydroxy-3-methylbutan-2-yl]carbamic acid |
| SMILES | CC(C)(O)[C@@H](Cc1ccc(C#N)cc1)NC(=O)O |
| InChI | InChI=1S/C13H16N2O3/c1-13(2,18)11(15-12(16)17)7-9-3-5-10(8-14)6-4-9/h3-6,11,15,18H,7H2,1-2H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | YWYOTXJQRMKMQH-LLVKDONJSA-N |
| XLogP | 1.51 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |