C14H18N2O4S — CID 43468038
2-[(4-cyanophenyl)methylsulfonylamino]-3,3-dimethylbutanoic acid (PubChem CID 43468038) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfonylamino]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[(4-cyanophenyl)methylsulfonylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 43468038 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfonylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)C(NS(=O)(=O)Cc1ccc(C#N)cc1)C(=O)O |
| InChI | InChI=1S/C14H18N2O4S/c1-14(2,3)12(13(17)18)16-21(19,20)9-11-6-4-10(8-15)5-7-11/h4-7,12,16H,9H2,1-3H3,(H,17,18) |
| InChIKey | YYKZQMHRZPOBLV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |