C10H10N2O5S — CID 60693504
2-[(4-cyanophenyl)methylsulfonylamino]oxyacetic acid (PubChem CID 60693504) has the molecular formula C10H10N2O5S and a molecular weight of 270.27 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfonylamino]oxyacetic acid.
| Compound Name | 2-[(4-cyanophenyl)methylsulfonylamino]oxyacetic acid |
|---|---|
| PubChem CID | 60693504 |
| Molecular Formula | C10H10N2O5S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfonylamino]oxyacetic acid |
| SMILES | N#Cc1ccc(CS(=O)(=O)NOCC(=O)O)cc1 |
| InChI | InChI=1S/C10H10N2O5S/c11-5-8-1-3-9(4-2-8)7-18(15,16)12-17-6-10(13)14/h1-4,12H,6-7H2,(H,13,14) |
| InChIKey | LXHHEPKHHVYUOL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|