C13H14N2O3 — CID 21338609
(2R)-2-[(4-cyanophenyl)methyl]-3-(dimethylamino)-3-oxopropanoic acid (PubChem CID 21338609) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is (2R)-2-[(4-cyanophenyl)methyl]-3-(dimethylamino)-3-oxopropanoic acid.
| Compound Name | (2R)-2-[(4-cyanophenyl)methyl]-3-(dimethylamino)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 21338609 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (2R)-2-[(4-cyanophenyl)methyl]-3-(dimethylamino)-3-oxopropanoic acid |
| SMILES | CN(C)C(=O)[C@@H](Cc1ccc(C#N)cc1)C(=O)O |
| InChI | InChI=1S/C13H14N2O3/c1-15(2)12(16)11(13(17)18)7-9-3-5-10(8-14)6-4-9/h3-6,11H,7H2,1-2H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | QVJSRAIVTBOJNU-LLVKDONJSA-N |
| XLogP | 0.89 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|