C27H31N3O4 — CID 21338614
(2S)-2-[[(2R)-3-[benzyl(methyl)amino]-2-[(4-cyanophenyl)methyl]-3-oxopropanoyl]amino]-2-cyclohexylacetic acid (PubChem CID 21338614) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is (2S)-2-[[(2R)-3-[benzyl(methyl)amino]-2-[(4-cyanophenyl)methyl]-3-oxopropanoyl]amino]-2-cyclohexylacetic acid.
| Compound Name | (2S)-2-[[(2R)-3-[benzyl(methyl)amino]-2-[(4-cyanophenyl)methyl]-3-oxopropanoyl]amino]-2-cyclohexylacetic acid |
|---|---|
| PubChem CID | 21338614 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (2S)-2-[[(2R)-3-[benzyl(methyl)amino]-2-[(4-cyanophenyl)methyl]-3-oxopropanoyl]amino]-2-cyclohexylacetic acid |
| SMILES | CN(Cc1ccccc1)C(=O)[C@H](Cc1ccc(C#N)cc1)C(=O)N[C@H](C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C27H31N3O4/c1-30(18-21-8-4-2-5-9-21)26(32)23(16-19-12-14-20(17-28)15-13-19)25(31)29-24(27(33)34)22-10-6-3-7-11-22/h2,4-5,8-9,12-15,22-24H,3,6-7,10-11,16,18H2,1H3,(H,29,31)(H,33,34)/t23-,24+/m1/s1 |
| InChIKey | HRHZXTYEJJKVKG-RPWUZVMVSA-N |
| XLogP | 3.53 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|