C10H9N3O4 — CID 90310855
[(carboxyamino)-(4-cyanophenyl)methyl]carbamic acid (PubChem CID 90310855) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is [(carboxyamino)-(4-cyanophenyl)methyl]carbamic acid.
| Compound Name | [(carboxyamino)-(4-cyanophenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 90310855 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | [(carboxyamino)-(4-cyanophenyl)methyl]carbamic acid |
| SMILES | N#Cc1ccc(C(NC(=O)O)NC(=O)O)cc1 |
| InChI | InChI=1S/C10H9N3O4/c11-5-6-1-3-7(4-2-6)8(12-9(14)15)13-10(16)17/h1-4,8,12-13H,(H,14,15)(H,16,17) |
| InChIKey | UALJEWSGAUUOML-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|