C14H18N2O2 — CID 69285161
[2-(4-cyanophenyl)-3,3-dimethylbutyl]carbamic acid (PubChem CID 69285161) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is [2-(4-cyanophenyl)-3,3-dimethylbutyl]carbamic acid.
| Compound Name | [2-(4-cyanophenyl)-3,3-dimethylbutyl]carbamic acid |
|---|---|
| PubChem CID | 69285161 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [2-(4-cyanophenyl)-3,3-dimethylbutyl]carbamic acid |
| SMILES | CC(C)(C)C(CNC(=O)O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H18N2O2/c1-14(2,3)12(9-16-13(17)18)11-6-4-10(8-15)5-7-11/h4-7,12,16H,9H2,1-3H3,(H,17,18) |
| InChIKey | CFMVUUHGWZNIGO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |