C10H14N4 — CID 130964172
4-(1,3-diaminopropan-2-ylamino)benzonitrile (PubChem CID 130964172) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 4-(1,3-diaminopropan-2-ylamino)benzonitrile.
| Compound Name | 4-(1,3-diaminopropan-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 130964172 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4-(1,3-diaminopropan-2-ylamino)benzonitrile |
| SMILES | N#Cc1ccc(NC(CN)CN)cc1 |
| InChI | InChI=1S/C10H14N4/c11-5-8-1-3-9(4-2-8)14-10(6-12)7-13/h1-4,10,14H,6-7,12-13H2 |
| InChIKey | MEUVIDRWLMFOKC-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |