(3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid

C16H15Cl2NO2 — CID 118438240

IUPAC(3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid
SMILESO=C(O)C[C@H](Cc1ccc(Cl)c(Cl)c1)Nc1ccccc1
InChIInChI=1S/C16H15Cl2NO2/c17-14-7-6-11(9-15(14)18)8-13(10-16(20)21)19-12-4-2-1-3-5-12/h1-7,9,13,19H,8,10H2,(H,20,21)/t13-/m0/s1
InChIKeySNFOBJDZPVYOAS-ZDUSSCGKSA-N
MW324.21 g/mol
LogP4.49
Rot. Bonds6

About (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid

(3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid (PubChem CID 118438240) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid.

Molecular Properties

Compound Name(3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid
PubChem CID118438240
Molecular FormulaC16H15Cl2NO2
Molecular Weight324.21 g/mol
Exact Mass323.05
IUPAC Name(3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid
SMILESO=C(O)C[C@H](Cc1ccc(Cl)c(Cl)c1)Nc1ccccc1
InChIInChI=1S/C16H15Cl2NO2/c17-14-7-6-11(9-15(14)18)8-13(10-16(20)21)19-12-4-2-1-3-5-12/h1-7,9,13,19H,8,10H2,(H,20,21)/t13-/m0/s1
InChIKeySNFOBJDZPVYOAS-ZDUSSCGKSA-N
XLogP4.49
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.21
LogP ≤ 54.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid?
The IUPAC name of (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid (CID 118438240) is (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid.
What is the SMILES notation for (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid?
The canonical SMILES for (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid is O=C(O)C[C@H](Cc1ccc(Cl)c(Cl)c1)Nc1ccccc1.
What is the InChIKey of (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid?
The InChIKey is SNFOBJDZPVYOAS-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H15Cl2NO2/c17-14-7-6-11(9-15(14)18)8-13(10-16(20)21)19-12-4-2-1-3-5-12/h1-7,9,13,19H,8,10H2,(H,20,21)/t13-/m0/s1.
What are the key properties of (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid?
(3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid has a molecular weight of 324.21 g/mol, XLogP of 4.49, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-anilino-4-(3,4-dichlorophenyl)butanoic acid is sourced from PubChem (CID 118438240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).