C19H20ClNO3 — CID 53340951
(3R)-3-[[2-(3-chlorophenyl)acetyl]amino]-5-phenylpentanoic acid (PubChem CID 53340951) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is (3R)-3-[[2-(3-chlorophenyl)acetyl]amino]-5-phenylpentanoic acid.
| Compound Name | (3R)-3-[[2-(3-chlorophenyl)acetyl]amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 53340951 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (3R)-3-[[2-(3-chlorophenyl)acetyl]amino]-5-phenylpentanoic acid |
| SMILES | O=C(O)C[C@@H](CCc1ccccc1)NC(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClNO3/c20-16-8-4-7-15(11-16)12-18(22)21-17(13-19(23)24)10-9-14-5-2-1-3-6-14/h1-8,11,17H,9-10,12-13H2,(H,21,22)(H,23,24)/t17-/m1/s1 |
| InChIKey | YZKYJHIRUIDSSX-QGZVFWFLSA-N |
| XLogP | 3.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |