C20H18N2O3S — CID 21108830
4-hydroxy-N'-[2-(naphthalen-1-ylmethylsulfanyl)acetyl]benzohydrazide (PubChem CID 21108830) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-hydroxy-N'-[2-(naphthalen-1-ylmethylsulfanyl)acetyl]benzohydrazide.
| Compound Name | 4-hydroxy-N'-[2-(naphthalen-1-ylmethylsulfanyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 21108830 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-hydroxy-N'-[2-(naphthalen-1-ylmethylsulfanyl)acetyl]benzohydrazide |
| SMILES | O=C(CSCc1cccc2ccccc12)NNC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c23-17-10-8-15(9-11-17)20(25)22-21-19(24)13-26-12-16-6-3-5-14-4-1-2-7-18(14)16/h1-11,23H,12-13H2,(H,21,24)(H,22,25) |
| InChIKey | AKWXTAZXTMPCJW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|