C16H14ClFN2O2S — CID 9037919
N'-[2-[(2-chlorophenyl)methylsulfanyl]acetyl]-4-fluorobenzohydrazide (PubChem CID 9037919) has the molecular formula C16H14ClFN2O2S and a molecular weight of 352.82 g/mol. Its IUPAC name is N'-[2-[(2-chlorophenyl)methylsulfanyl]acetyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[2-[(2-chlorophenyl)methylsulfanyl]acetyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 9037919 |
| Molecular Formula | C16H14ClFN2O2S |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | N'-[2-[(2-chlorophenyl)methylsulfanyl]acetyl]-4-fluorobenzohydrazide |
| SMILES | O=C(CSCc1ccccc1Cl)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14ClFN2O2S/c17-14-4-2-1-3-12(14)9-23-10-15(21)19-20-16(22)11-5-7-13(18)8-6-11/h1-8H,9-10H2,(H,19,21)(H,20,22) |
| InChIKey | ISWIRUKYORMFOR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|