C18H17NO2S — CID 31087778
N-(furan-2-ylmethyl)-2-(naphthalen-1-ylmethylsulfanyl)acetamide (PubChem CID 31087778) has the molecular formula C18H17NO2S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(naphthalen-1-ylmethylsulfanyl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(naphthalen-1-ylmethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 31087778 |
| Molecular Formula | C18H17NO2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(naphthalen-1-ylmethylsulfanyl)acetamide |
| SMILES | O=C(CSCc1cccc2ccccc12)NCc1ccco1 |
| InChI | InChI=1S/C18H17NO2S/c20-18(19-11-16-8-4-10-21-16)13-22-12-15-7-3-6-14-5-1-2-9-17(14)15/h1-10H,11-13H2,(H,19,20) |
| InChIKey | SHWZKEYRVBXYPT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |