C14H13ClFNO2S — CID 51168885
2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 51168885) has the molecular formula C14H13ClFNO2S and a molecular weight of 313.78 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 51168885 |
| Molecular Formula | C14H13ClFNO2S |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CSCc1ccc(F)cc1Cl)NCc1ccco1 |
| InChI | InChI=1S/C14H13ClFNO2S/c15-13-6-11(16)4-3-10(13)8-20-9-14(18)17-7-12-2-1-5-19-12/h1-6H,7-9H2,(H,17,18) |
| InChIKey | KINXRCCZGXBYAF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |